Question

3. A metal carbonate P' on reacting with an acid gives a gas 'Q', which when
passed through a solution 'R' turns it milky. On the other hand a gas 'S' that is
obtained at anode during electrolysis of brine is passed on dry 'R', it gives a
compound 'T' used for disinfecting drinking water Identify P.Q.R.S.Tand
utite the chemical reaction between 'R' and 'S'.
(3)​

Answer 1

Explanation:

P is sodium carbonate (NaCO3)

Q is hydrochloric acid (hcl)

R is lime water (calcium hydroxide) [Ca(OH)2]

S is carbon dioxide gas (CO2)

T is bleaching powder (calcium hypochlorite) [Ca(Clo)3]

reaction between R and S is Ca(OH)2+CO2-------Ca(Clo)3+H2O

hope this helps you