A certain alcoholic beverage contains only ethanol (c2h6o) and water. When a sample of this beverage undergoes combustion, the ethanol burns but the water simply evaporates and is collected along with the water produced by combustion. The combustion reaction is c2h6o(l)+3o2(g)2co2(g)+3h2o(g) when a 10.12 g sample of this beverage is burned, 11.59 g of water is collected.
Answers
The type of alcohol in the alcoholic drinks we drink is a chemical called ethanol.To make alcohol, you need to put grains, fruits or vegetables through a process called fermentation (when yeast or bacteria react with the sugars in food - the by-products are ethanol and carbon dioxide).
Answer:
A certain alcoholic beverage contains only ethanol (C2H6O) and water. When a sample of this beverage undergoes combustion, the ethanol burns but the water simply evaporates and is collected along with the water produced by combustion. The combustion reaction is:
C2H6O(l)+3O2(g)?2CO2(g)+3H2O(g)
When a 10.67 g sample of this beverage is burned, 11.58 g of water is collected.
1.) What is the mass in grams of ethanol in the original sample? Express your answer using two decimal places.
2.) What is the mass of water in the original sample? Express your answer using two decimal places.