Question

A Compound x has molecular formula C₂ H8O
and reacts with sodium metal to produce
hydrogen gas identify the compound, funcition
group or reaction.​

Answer 1

Answer:

The compound is forming C2H4O on oxidation and it is evolving hydrogen gas with sodium metal.

The compound that is formed is ethanal and the given compound is ethanol (C2H6O) or C2H5OH which gives positive iodoform test.

CH3CH2OH+[O]Na2Cr2O7/H+CH3CHO+H2O

Option D is correct.