Question

b) Write IUPAC names of the following ? i) CH2-CO-CH(CH3)-CH2-CH2Cl.​

Answer 1

Numbering… will start from the last carbon atom to the first carbon atom as we prioritize the functional group, the LEAST !

CH³-CH²-CH=CO-CH²Cl

So, here are 5 carbon atoms.

We have chlorine attached to the first carbon atom and ketonic group on 2nd carbon atom..

So the name is. 1-chloro,pentan-2-one