Question

CH3-CH2CH2CL=CH3CH(OH)CH3

Answer 1

In which case (numbering from right to left because chloro precedes methyl) the IUPAC name (I assume it’s the preferred name) is 1-chloro-3-methylbutane. It also has the common names isopentyl chloride and isoamyl chloride.

Now, CH3CH(CH3) CH2CH2CI (as inputted by OP) has a divalent carbon (C) bonded to iodine (I). Divalent carbon compounds exist, but they are usually highly reactive; you certainly wouldn’t find this in a reagent bottle. As for the name, it would probably be called 1-iodo-4-methylpent-1-ylidene.