Draw the Lewis dot and cross diagram to show the formation of Coordinate covalent bond between water molecule (H2O ) and ( H+) ion. The final particle formed is Hydronium ion H3O+
Answers
Answer
The reaction is
NH3(g)+HCl(g)→NH4Cl(s)(1)(1)NH3(g)+HCl(g)→NH4Cl(s)
Ammonium ions, NH4+, are formed by the transfer of a hydrogen ion (a proton) from the hydrogen chloride molecule to the lone pair of electrons on the ammonia molecule.

When the ammonium ion, NH4+, is formed, the fourth hydrogen is attached by a dative covalent bond, because only the hydrogen's nucleus is transferred from the chlorine to the nitrogen. The hydrogen's electron is left behind on the chlorine to form a negative chloride ion. Once the ammonium ion has been formed it is impossible to tell any difference between the dative covalent and the ordinary covalent bonds. Although the electrons are shown differently in the diagram, there is no difference between them in reality.

In simple diagrams, a coordinate bond is shown by an arrow. The arrow points from the atom donating the lone pair to the atom accepting it.