Fermentation that leads to the production of ethanol is often referred to as anaerobic respiration, why? because it involves the glycolytic pathway because o2 is consumed because pyruvate is consumed because co2 is released
Answers
Answered by
0
Fermentation is respiration anagonastic to aerobic one. So, it is going to be something rather than consumption of oxygen atoms in their molecular forms. Shifting towards the more simpler hand of physiology it’s a part of aerobic respiration that includes glycolysis,kerb cycle,ETS system.
Leaving behind the glycolysis, all others involves mitochondrial functions, so the aim is very clear, glycolysis is the only anaerobical part of aerobic respiration.
The exclusive glycolysis leads the pyruvic acid is the product that undergoes decarboxylation , reduction in a carbon and oxygen molecule.
Further, the product is reduced under the conditions of NADH2.
CH3COCOOH= CH3CHO+ CO2
CH3CHO+NADH2=CH3CH2OH(C2H5OH)
Similar questions