Question

how is soap prepared ? balanced reaction ?

Answer 1

the alkaline hydrolisis of ester forms soap
CH3COOC2H5+NaOH------>CH3COONa+C2H5OH

Answer 2

Soaps are sodium or potassium salts of long chain fatty acids. When triglycerides in fat/oil react with aqueous NaOH or KOH, they are converted into soap and glycerol. ... Since this reaction leads to the formation of soap, it is called the Saponification process.


balance: CH3(CH2)4CH=CHCH2CH=CH(CH2)7COOH