Question

Plz help me !
tomorrow is my exam.
write a balanced equation for each of the following reactions :
1). Thermal decomposition of zinc carbonate.
2). Addition of dilute hydrochloric acid to calcium carbonate .
3).Reactions of copper oxide and dilute sulphuric acid .
4).reaction of lead nitrate solution and sodium chloride solution
5). A weak acid formed by the reaction of carbon dioxide and water .

Answer 1

5) carbonic acid
3) cuO + H2SO4 >cuSO4 + H2O
1)ZnO + CO2

Answer 2

1. ZnCO3 = ZnO + CO

2. CaCO3+2HCl=CaCl2+H2O=CO2

3. CuO+H2SO4=CuSO4+H20

4. Pb(NO3)2+2NaCl=PbCl2+2NaNO3

5. CO2+H20=H2CO3

 The acid formed in carbonic acid

Hope this helps u..

All the best