Science, asked by roybipin995, 8 months ago

What does a neuron look like?​

Answers

Answered by wordsdaily101
7

Answer:

A neuron is a cell that carries electrical impulses.  They are the basic units of the nervous system, Every neuron is made of a cell body, dendrites, and an axon.

Neurons have a large number of extensions called dendrites. They often look likes branches or spikes extending out from the cell body. It is primarily the surfaces of the dendrites that receive chemical messages from other neurons.  Dendrites and axons are nerve fibers.

Attachments:
Answered by MrVampire01
0

Explanation:

We Should Know Some Trignometric Identities For Solving This Question.

━━━━━━━━━━━━━━━━━━━━━━━━━━

\begin{gathered}1. \: \: \sin(2 \alpha ) = 2 \sin( \alpha ) \cos( \alpha ) \\\end{gathered} </p><p>1.sin(2α)=2sin(α)cos(α)

2. \: \: \sin(180 - \alpha ) = \sin( \alpha )2.sin(180−α)=sin(α)

3. \: \: \sin(90 - \alpha ) = \cos( \alpha )3.sin(90−α)=cos(α)

━━━━━━━━━━━━━━━━━━━━━━━━━━

L.H.S :- Sin10. Sin30. Sin50. Sin70

\begin{gathered}= \cos(90 - 10) \sin(30) \cos(90 - 40) \cos(90 - 70) \\ = \cos(80) \: \frac{1}{2} \: \cos(40) \: \cos(20) \\ = \frac{1}{4 \sin(20) } \cos(8 0 ) \cos(40) . \: 2 \sin(20) \cos(20) \\ = \frac{1}{8 \sin(20) } \cos(80) 2. \cos(40) \sin(40) \\ = \frac{1}{16 \sin(20) } 2 \cos(80) \sin(80 ) \\ = \frac{1}{16 \sin(20) } \sin(160) \\ = \frac{1}{16 \sin(20) } \sin(180 - 20) \\ = \frac{1}{16 \sin(20) } \sin(20) \\ = \frac{1}{16} \: \: \: \: \: \: \: \: .........R.H.S\end{gathered}

=cos(90−10)sin(30)cos(90−40)cos(90−70)

=cos(80) 2/1

cos(40)cos(20)= 4sin(20)1

cos(80)cos(40).2sin(20)cos(20)= 8sin(20)1

cos(80)2.cos(40)sin(40)= 16sin(20)1

2cos(80)sin(80)= 16sin(20)1

sin(160)= 16sin(20)1

sin(180−20)= 16sin(20)1

sin(20)= 16/1

.........R.H.S,

Similar questions