Question

What is observed when ca(oh)2 reaction with nitric acid

Answer 1

Answer:

Nitric acid has the chemical formula HNO3, and Calcium Hydroxide has the chemical formula Ca(OH)2. When an acid and a base react with each other, the products that are formed is a salt (an ionic compound that is formed from a reaction between an acid and a base) and water.

Ca(OH)2 + 2HNO3 → Ca(NO3)2 + 2H2O

Answer 2

Explanation:

when ca(oh)2 reacts with Hno3 then this reaction became an example of base reacting with an acid....

therefor, salt and h20 is formed that is

Ca(oh)2+Hno3=Ca(No3)2+h2o

hope to will be helpful to you