Question

what is the chemical formula of ditergent?​

Answer 1

Explanation:

Detergents usually made out of surfactants. Basicly, if we assume the molecule as a chain, one end of the chain prefers to stay in the water (hydrophilic) while the other end prefers to stay out of the water

(hydrophobic) CH3-CH2-CH2-CH2-CH2-CH2-CH2-CH2-CH2-CH2-CH2-CH2-CH2-CH2-CH2-CH2-CH2-COO(-) Na(+).

Answer 2

Hey mate✌

Washing soda is a chemical compound with the formula Na2CO3, known as sodium carbonate, and it's a salt of carbonic acid.

It is also used as detergent, so the chemical formula for detergent is Na2CO3.

Plz mark my answer as brainliest answer...✌✌