Question

Give balanced chemical equations to prepare the
following salts:
(i) Lead sulphate from lead carbonate.
(ii) Sodium sulphate using dilute sulphuric acid.
(iii) Copper chloride using copper carbonate.​

Answer 1

Answer:

for 1 answer notes - First convert lead carbonate to lead nitrate by reacting with dil.nitric acid

Then react with sulphuric acid above 200°C to form lead sulphate

Answer 2

Answer:

1. pbco3+2HNO3=pb(No3)2+H2O+CO2
2. pb(No3) +H2SO4=PbSO4+2HNO3
3. 2NaCl(s)+H2SO4(l)=Na2SO4+2HCl(g)