Question

what is the IUPAC name of CH3-(CH3)2-CH2-CH2-CH2-CHO​

Answer 1

Answer:

5,5- Dimethylhexanal

Answer 2

Butanal in IUPAC naming system

Explanation:

1. As you can see the chain contains 4 carbon atoms in linear arrangement .
2. So the compound is a derivative of n-butane butit is not butane as it also contains oxygen atom .
3. Now when you see the last part you will find that in order to satisfy valency of carbon , oxygen is making double bond with carbon atom hence it must be or rather should be a carbonyl group >C=O
4. And hence the compound is a carbonyl compound but as the group is present at the end of compound and is not further substituted by any other group it is an aldehyde group .
5. So the compound is known as Butanal in IUPAC naming system

Also known as Butyraldehyde in common naming system