Question

what's the name of this compound Ch3-c(cl)=c(nh2)-ch2-ch(cl)-ch3​

Answer 1

Answer:

ane = an alkane ene = an alkene yne = an alkyne 3. The prefix: Tells what groups, or branches are attached to the parent chain. methyl = - CH3 ethyl = - CH2- CH3 propyl = -CH2-CH2-CH3 4. The location: Tells where groups, or branches, are attached to the parent chain.

Explanation:

pls follow ❤️

hope it helps