CaCO2+H2O----------Ca(OH)2+C2H2 HOW IT BALANCE
Answers
Answered by
1
you did something wrong while you giving this reaction here,
there are no such compound as CaCO2
the correct one is CaC2 (calcium carbide)+H2O --------> Ca(OH)2+C2H2 (which is already balanced!!! :-) )
there are no such compound as CaCO2
the correct one is CaC2 (calcium carbide)+H2O --------> Ca(OH)2+C2H2 (which is already balanced!!! :-) )
Similar questions